C11H15BrF3N3OS — CID 114442609
4-bromo-5-(4-methylsulfanylbutylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one (PubChem CID 114442609) has the molecular formula C11H15BrF3N3OS and a molecular weight of 374.23 g/mol. Its IUPAC name is 4-bromo-5-(4-methylsulfanylbutylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one.
| Compound Name | 4-bromo-5-(4-methylsulfanylbutylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114442609 |
| Molecular Formula | C11H15BrF3N3OS |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 4-bromo-5-(4-methylsulfanylbutylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
| SMILES | CSCCCCNc1cnn(CC(F)(F)F)c(=O)c1Br |
| InChI | InChI=1S/C11H15BrF3N3OS/c1-20-5-3-2-4-16-8-6-17-18(7-11(13,14)15)10(19)9(8)12/h6,16H,2-5,7H2,1H3 |
| InChIKey | PEPHWACIAWVCKI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|