C10H14BrN3OS — CID 114438269
4-bromo-5-(2-methylsulfanylethylamino)-2-prop-2-enylpyridazin-3-one (PubChem CID 114438269) has the molecular formula C10H14BrN3OS and a molecular weight of 304.21 g/mol. Its IUPAC name is 4-bromo-5-(2-methylsulfanylethylamino)-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-bromo-5-(2-methylsulfanylethylamino)-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114438269 |
| Molecular Formula | C10H14BrN3OS |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 4-bromo-5-(2-methylsulfanylethylamino)-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NCCSC)c(Br)c1=O |
| InChI | InChI=1S/C10H14BrN3OS/c1-3-5-14-10(15)9(11)8(7-13-14)12-4-6-16-2/h3,7,12H,1,4-6H2,2H3 |
| InChIKey | RMCCNTBILPUZQI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|