C11H17BrN4O — CID 114444573
4-bromo-5-[2-(ethylamino)ethylamino]-2-prop-2-enylpyridazin-3-one (PubChem CID 114444573) has the molecular formula C11H17BrN4O and a molecular weight of 301.19 g/mol. Its IUPAC name is 4-bromo-5-[2-(ethylamino)ethylamino]-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-bromo-5-[2-(ethylamino)ethylamino]-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114444573 |
| Molecular Formula | C11H17BrN4O |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 4-bromo-5-[2-(ethylamino)ethylamino]-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NCCNCC)c(Br)c1=O |
| InChI | InChI=1S/C11H17BrN4O/c1-3-7-16-11(17)10(12)9(8-15-16)14-6-5-13-4-2/h3,8,13-14H,1,4-7H2,2H3 |
| InChIKey | XKORJWRKVDWCLG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|