C11H16BrN3O — CID 114431484
4-bromo-5-(butan-2-ylamino)-2-prop-2-enylpyridazin-3-one (PubChem CID 114431484) has the molecular formula C11H16BrN3O and a molecular weight of 286.17 g/mol. Its IUPAC name is 4-bromo-5-(butan-2-ylamino)-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-bromo-5-(butan-2-ylamino)-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114431484 |
| Molecular Formula | C11H16BrN3O |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 4-bromo-5-(butan-2-ylamino)-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NC(C)CC)c(Br)c1=O |
| InChI | InChI=1S/C11H16BrN3O/c1-4-6-15-11(16)10(12)9(7-13-15)14-8(3)5-2/h4,7-8,14H,1,5-6H2,2-3H3 |
| InChIKey | WJVNGCGUBGFNAT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|