C13H21BrN4O — CID 114446868
5-[(1-amino-2,3-dimethylbutan-2-yl)amino]-4-bromo-2-prop-2-enylpyridazin-3-one (PubChem CID 114446868) has the molecular formula C13H21BrN4O and a molecular weight of 329.24 g/mol. Its IUPAC name is 5-[(1-amino-2,3-dimethylbutan-2-yl)amino]-4-bromo-2-prop-2-enylpyridazin-3-one.
| Compound Name | 5-[(1-amino-2,3-dimethylbutan-2-yl)amino]-4-bromo-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114446868 |
| Molecular Formula | C13H21BrN4O |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 5-[(1-amino-2,3-dimethylbutan-2-yl)amino]-4-bromo-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NC(C)(CN)C(C)C)c(Br)c1=O |
| InChI | InChI=1S/C13H21BrN4O/c1-5-6-18-12(19)11(14)10(7-16-18)17-13(4,8-15)9(2)3/h5,7,9,17H,1,6,8,15H2,2-4H3 |
| InChIKey | YOYPLUIFBDGIKK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|