C12H14BrN5O — CID 106214190
4-bromo-2-prop-2-enyl-5-[1-(1H-pyrazol-4-yl)ethylamino]pyridazin-3-one (PubChem CID 106214190) has the molecular formula C12H14BrN5O and a molecular weight of 324.18 g/mol. Its IUPAC name is 4-bromo-2-prop-2-enyl-5-[1-(1H-pyrazol-4-yl)ethylamino]pyridazin-3-one.
| Compound Name | 4-bromo-2-prop-2-enyl-5-[1-(1H-pyrazol-4-yl)ethylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 106214190 |
| Molecular Formula | C12H14BrN5O |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 4-bromo-2-prop-2-enyl-5-[1-(1H-pyrazol-4-yl)ethylamino]pyridazin-3-one |
| SMILES | C=CCn1ncc(NC(C)c2cn[nH]c2)c(Br)c1=O |
| InChI | InChI=1S/C12H14BrN5O/c1-3-4-18-12(19)11(13)10(7-16-18)17-8(2)9-5-14-15-6-9/h3,5-8,17H,1,4H2,2H3,(H,14,15) |
| InChIKey | BBFKYMWOHPIWJV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|