C13H15BrN4OS — CID 114438791
4-bromo-5-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-2-prop-2-enylpyridazin-3-one (PubChem CID 114438791) has the molecular formula C13H15BrN4OS and a molecular weight of 355.26 g/mol. Its IUPAC name is 4-bromo-5-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-bromo-5-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114438791 |
| Molecular Formula | C13H15BrN4OS |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 4-bromo-5-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NC(C)c2nc(C)cs2)c(Br)c1=O |
| InChI | InChI=1S/C13H15BrN4OS/c1-4-5-18-13(19)11(14)10(6-15-18)17-9(3)12-16-8(2)7-20-12/h4,6-7,9,17H,1,5H2,2-3H3 |
| InChIKey | GZAQXAPPEMRNKX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|