C14H21BrN4O2 — CID 114441577
2-[(5-bromo-6-oxo-1-prop-2-enylpyridazin-4-yl)amino]-N,N-diethylpropanamide (PubChem CID 114441577) has the molecular formula C14H21BrN4O2 and a molecular weight of 357.25 g/mol. Its IUPAC name is 2-[(5-bromo-6-oxo-1-prop-2-enylpyridazin-4-yl)amino]-N,N-diethylpropanamide.
| Compound Name | 2-[(5-bromo-6-oxo-1-prop-2-enylpyridazin-4-yl)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 114441577 |
| Molecular Formula | C14H21BrN4O2 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-[(5-bromo-6-oxo-1-prop-2-enylpyridazin-4-yl)amino]-N,N-diethylpropanamide |
| SMILES | C=CCn1ncc(NC(C)C(=O)N(CC)CC)c(Br)c1=O |
| InChI | InChI=1S/C14H21BrN4O2/c1-5-8-19-14(21)12(15)11(9-16-19)17-10(4)13(20)18(6-2)7-3/h5,9-10,17H,1,6-8H2,2-4H3 |
| InChIKey | GPQKMNNWYUUSHY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|