C12H17BrF3N3O2 — CID 107850388
4-bromo-5-(6-hydroxyhexylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one (PubChem CID 107850388) has the molecular formula C12H17BrF3N3O2 and a molecular weight of 372.19 g/mol. Its IUPAC name is 4-bromo-5-(6-hydroxyhexylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one.
| Compound Name | 4-bromo-5-(6-hydroxyhexylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 107850388 |
| Molecular Formula | C12H17BrF3N3O2 |
| Molecular Weight | 372.19 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 4-bromo-5-(6-hydroxyhexylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
| SMILES | O=c1c(Br)c(NCCCCCCO)cnn1CC(F)(F)F |
| InChI | InChI=1S/C12H17BrF3N3O2/c13-10-9(17-5-3-1-2-4-6-20)7-18-19(11(10)21)8-12(14,15)16/h7,17,20H,1-6,8H2 |
| InChIKey | ARSLFUGXWGUZAP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|