C17H12BrCl2N3O — CID 46887098
5-(benzylamino)-4-bromo-2-(2,6-dichlorophenyl)pyridazin-3-one (PubChem CID 46887098) has the molecular formula C17H12BrCl2N3O and a molecular weight of 425.11 g/mol. Its IUPAC name is 5-(benzylamino)-4-bromo-2-(2,6-dichlorophenyl)pyridazin-3-one.
| Compound Name | 5-(benzylamino)-4-bromo-2-(2,6-dichlorophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 46887098 |
| Molecular Formula | C17H12BrCl2N3O |
| Molecular Weight | 425.11 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | 5-(benzylamino)-4-bromo-2-(2,6-dichlorophenyl)pyridazin-3-one |
| SMILES | O=c1c(Br)c(NCc2ccccc2)cnn1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H12BrCl2N3O/c18-15-14(21-9-11-5-2-1-3-6-11)10-22-23(17(15)24)16-12(19)7-4-8-13(16)20/h1-8,10,21H,9H2 |
| InChIKey | CSIAPGGZHAGSRU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.11 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |