C14H13BrClN3O — CID 114431095
4-bromo-5-[(4-chlorophenyl)methylamino]-2-prop-2-enylpyridazin-3-one (PubChem CID 114431095) has the molecular formula C14H13BrClN3O and a molecular weight of 354.64 g/mol. Its IUPAC name is 4-bromo-5-[(4-chlorophenyl)methylamino]-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-bromo-5-[(4-chlorophenyl)methylamino]-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114431095 |
| Molecular Formula | C14H13BrClN3O |
| Molecular Weight | 354.64 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 4-bromo-5-[(4-chlorophenyl)methylamino]-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NCc2ccc(Cl)cc2)c(Br)c1=O |
| InChI | InChI=1S/C14H13BrClN3O/c1-2-7-19-14(20)13(15)12(9-18-19)17-8-10-3-5-11(16)6-4-10/h2-6,9,17H,1,7-8H2 |
| InChIKey | XWYGDJPKQMZXNJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.64 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|