C15H15BrFN3O — CID 114433588
4-bromo-5-[2-(3-fluorophenyl)ethylamino]-2-prop-2-enylpyridazin-3-one (PubChem CID 114433588) has the molecular formula C15H15BrFN3O and a molecular weight of 352.21 g/mol. Its IUPAC name is 4-bromo-5-[2-(3-fluorophenyl)ethylamino]-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-bromo-5-[2-(3-fluorophenyl)ethylamino]-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114433588 |
| Molecular Formula | C15H15BrFN3O |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 4-bromo-5-[2-(3-fluorophenyl)ethylamino]-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NCCc2cccc(F)c2)c(Br)c1=O |
| InChI | InChI=1S/C15H15BrFN3O/c1-2-8-20-15(21)14(16)13(10-19-20)18-7-6-11-4-3-5-12(17)9-11/h2-5,9-10,18H,1,6-8H2 |
| InChIKey | OULIEJUIWHSEOM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|