C12H12BrN3O — CID 19576393
4-bromo-1-methyl-N-(3-methylphenyl)pyrazole-5-carboxamide (PubChem CID 19576393) has the molecular formula C12H12BrN3O and a molecular weight of 294.15 g/mol. Its IUPAC name is 4-bromo-1-methyl-N-(3-methylphenyl)pyrazole-5-carboxamide.
| Compound Name | 4-bromo-1-methyl-N-(3-methylphenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19576393 |
| Molecular Formula | C12H12BrN3O |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 4-bromo-1-methyl-N-(3-methylphenyl)pyrazole-5-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2c(Br)cnn2C)c1 |
| InChI | InChI=1S/C12H12BrN3O/c1-8-4-3-5-9(6-8)15-12(17)11-10(13)7-14-16(11)2/h3-7H,1-2H3,(H,15,17) |
| InChIKey | FKIJPFGWFGTARM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |