C19H19BrN4O2 — CID 137492363
1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3-methylphenyl)urea (PubChem CID 137492363) has the molecular formula C19H19BrN4O2 and a molecular weight of 415.29 g/mol. Its IUPAC name is 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 137492363 |
| Molecular Formula | C19H19BrN4O2 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3-methylphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2cccc(C)c2)cc1-c1c(Br)cnn1C |
| InChI | InChI=1S/C19H19BrN4O2/c1-12-5-4-6-13(9-12)22-19(25)23-14-7-8-17(26-3)15(10-14)18-16(20)11-21-24(18)2/h4-11H,1-3H3,(H2,22,23,25) |
| InChIKey | UQHPYYCUJRDUAM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |