C22H19BrN4O2 — CID 11775306
1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-naphthalen-2-ylurea (PubChem CID 11775306) has the molecular formula C22H19BrN4O2 and a molecular weight of 451.32 g/mol. Its IUPAC name is 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-naphthalen-2-ylurea.
| Compound Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-naphthalen-2-ylurea |
|---|---|
| PubChem CID | 11775306 |
| Molecular Formula | C22H19BrN4O2 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-naphthalen-2-ylurea |
| SMILES | COc1ccc(NC(=O)Nc2ccc3ccccc3c2)cc1-c1c(Br)cnn1C |
| InChI | InChI=1S/C22H19BrN4O2/c1-27-21(19(23)13-24-27)18-12-17(9-10-20(18)29-2)26-22(28)25-16-8-7-14-5-3-4-6-15(14)11-16/h3-13H,1-2H3,(H2,25,26,28) |
| InChIKey | KAFGOCVYMMREPV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |