C18H16BrClN4O3 — CID 23139514
1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(4-chloro-2-hydroxyphenyl)urea (PubChem CID 23139514) has the molecular formula C18H16BrClN4O3 and a molecular weight of 451.71 g/mol. Its IUPAC name is 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(4-chloro-2-hydroxyphenyl)urea.
| Compound Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(4-chloro-2-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 23139514 |
| Molecular Formula | C18H16BrClN4O3 |
| Molecular Weight | 451.71 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(4-chloro-2-hydroxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(Cl)cc2O)cc1-c1c(Br)cnn1C |
| InChI | InChI=1S/C18H16BrClN4O3/c1-24-17(13(19)9-21-24)12-8-11(4-6-16(12)27-2)22-18(26)23-14-5-3-10(20)7-15(14)25/h3-9,25H,1-2H3,(H2,22,23,26) |
| InChIKey | SVAWFKOMRPXLOY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.71 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|