C21H23BrFN5O3 — CID 23139520
1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-[2-(dimethylamino)ethoxy]phenyl]-3-(4-fluoro-2-hydroxyphenyl)urea (PubChem CID 23139520) has the molecular formula C21H23BrFN5O3 and a molecular weight of 492.35 g/mol. Its IUPAC name is 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-[2-(dimethylamino)ethoxy]phenyl]-3-(4-fluoro-2-hydroxyphenyl)urea.
| Compound Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-[2-(dimethylamino)ethoxy]phenyl]-3-(4-fluoro-2-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 23139520 |
| Molecular Formula | C21H23BrFN5O3 |
| Molecular Weight | 492.35 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-[2-(dimethylamino)ethoxy]phenyl]-3-(4-fluoro-2-hydroxyphenyl)urea |
| SMILES | CN(C)CCOc1ccc(NC(=O)Nc2ccc(F)cc2O)cc1-c1c(Br)cnn1C |
| InChI | InChI=1S/C21H23BrFN5O3/c1-27(2)8-9-31-19-7-5-14(11-15(19)20-16(22)12-24-28(20)3)25-21(30)26-17-6-4-13(23)10-18(17)29/h4-7,10-12,29H,8-9H2,1-3H3,(H2,25,26,30) |
| InChIKey | TZYABACDRVMYEB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|