C23H30FN5O3 — CID 142996321
1-[4-[2-(dimethylamino)ethoxy]-3-[1-[methyl-[(Z)-propylideneamino]amino]ethenyl]phenyl]-3-(4-fluoro-2-hydroxyphenyl)urea (PubChem CID 142996321) has the molecular formula C23H30FN5O3 and a molecular weight of 443.52 g/mol. Its IUPAC name is 1-[4-[2-(dimethylamino)ethoxy]-3-[1-[methyl-[(Z)-propylideneamino]amino]ethenyl]phenyl]-3-(4-fluoro-2-hydroxyphenyl)urea.
| Compound Name | 1-[4-[2-(dimethylamino)ethoxy]-3-[1-[methyl-[(Z)-propylideneamino]amino]ethenyl]phenyl]-3-(4-fluoro-2-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 142996321 |
| Molecular Formula | C23H30FN5O3 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 1-[4-[2-(dimethylamino)ethoxy]-3-[1-[methyl-[(Z)-propylideneamino]amino]ethenyl]phenyl]-3-(4-fluoro-2-hydroxyphenyl)urea |
| SMILES | C=C(c1cc(NC(=O)Nc2ccc(F)cc2O)ccc1OCCN(C)C)N(C)/N=C\CC |
| InChI | InChI=1S/C23H30FN5O3/c1-6-11-25-29(5)16(2)19-15-18(8-10-22(19)32-13-12-28(3)4)26-23(31)27-20-9-7-17(24)14-21(20)30/h7-11,14-15,30H,2,6,12-13H2,1,3-5H3,(H2,26,27,31)/b25-11- |
| InChIKey | HSOVZLIXFOLJNO-GATIEOLUSA-N |
| XLogP | 4.41 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|