C22H28ClN5O3 — CID 142996312
1-(4-chloro-3-hydroxyphenyl)-3-[4-[2-(dimethylamino)ethoxy]-3-[(Z)-1-[methyl-(methylideneamino)amino]prop-1-enyl]phenyl]urea (PubChem CID 142996312) has the molecular formula C22H28ClN5O3 and a molecular weight of 445.95 g/mol. Its IUPAC name is 1-(4-chloro-3-hydroxyphenyl)-3-[4-[2-(dimethylamino)ethoxy]-3-[(Z)-1-[methyl-(methylideneamino)amino]prop-1-enyl]phenyl]urea.
| Compound Name | 1-(4-chloro-3-hydroxyphenyl)-3-[4-[2-(dimethylamino)ethoxy]-3-[(Z)-1-[methyl-(methylideneamino)amino]prop-1-enyl]phenyl]urea |
|---|---|
| PubChem CID | 142996312 |
| Molecular Formula | C22H28ClN5O3 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 1-(4-chloro-3-hydroxyphenyl)-3-[4-[2-(dimethylamino)ethoxy]-3-[(Z)-1-[methyl-(methylideneamino)amino]prop-1-enyl]phenyl]urea |
| SMILES | C=NN(C)/C(=C\C)c1cc(NC(=O)Nc2ccc(Cl)c(O)c2)ccc1OCCN(C)C |
| InChI | InChI=1S/C22H28ClN5O3/c1-6-19(28(5)24-2)17-13-15(8-10-21(17)31-12-11-27(3)4)25-22(30)26-16-7-9-18(23)20(29)14-16/h6-10,13-14,29H,2,11-12H2,1,3-5H3,(H2,25,26,30)/b19-6- |
| InChIKey | DMOJEZYEFPEAKY-SWNXQHNESA-N |
| XLogP | 4.54 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|