C18H22BrClIN3O2 — CID 44533219
1-(4-bromo-3-methylphenyl)-3-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]urea;hydrochloride (PubChem CID 44533219) has the molecular formula C18H22BrClIN3O2 and a molecular weight of 554.65 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]urea;hydrochloride.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]urea;hydrochloride |
|---|---|
| PubChem CID | 44533219 |
| Molecular Formula | C18H22BrClIN3O2 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 552.96 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]urea;hydrochloride |
| SMILES | Cc1cc(NC(=O)Nc2ccc(I)c(OCCN(C)C)c2)ccc1Br.Cl |
| InChI | InChI=1S/C18H21BrIN3O2.ClH/c1-12-10-13(4-6-15(12)19)21-18(24)22-14-5-7-16(20)17(11-14)25-9-8-23(2)3;/h4-7,10-11H,8-9H2,1-3H3,(H2,21,22,24);1H |
| InChIKey | NSRXMOIROUPETK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|