C17H19IN4O4 — CID 54446553
1-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-3-(2-nitrophenyl)urea (PubChem CID 54446553) has the molecular formula C17H19IN4O4 and a molecular weight of 470.27 g/mol. Its IUPAC name is 1-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-3-(2-nitrophenyl)urea.
| Compound Name | 1-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-3-(2-nitrophenyl)urea |
|---|---|
| PubChem CID | 54446553 |
| Molecular Formula | C17H19IN4O4 |
| Molecular Weight | 470.27 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 1-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-3-(2-nitrophenyl)urea |
| SMILES | CN(C)CCOc1cc(NC(=O)Nc2ccccc2[N+](=O)[O-])ccc1I |
| InChI | InChI=1S/C17H19IN4O4/c1-21(2)9-10-26-16-11-12(7-8-13(16)18)19-17(23)20-14-5-3-4-6-15(14)22(24)25/h3-8,11H,9-10H2,1-2H3,(H2,19,20,23) |
| InChIKey | WRXRFPHYMSKSDI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|