C19H23N3O6 — CID 108869608
1-(2-nitrophenyl)-3-(3,4,5-triethoxyphenyl)urea (PubChem CID 108869608) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is 1-(2-nitrophenyl)-3-(3,4,5-triethoxyphenyl)urea.
| Compound Name | 1-(2-nitrophenyl)-3-(3,4,5-triethoxyphenyl)urea |
|---|---|
| PubChem CID | 108869608 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-(2-nitrophenyl)-3-(3,4,5-triethoxyphenyl)urea |
| SMILES | CCOc1cc(NC(=O)Nc2ccccc2[N+](=O)[O-])cc(OCC)c1OCC |
| InChI | InChI=1S/C19H23N3O6/c1-4-26-16-11-13(12-17(27-5-2)18(16)28-6-3)20-19(23)21-14-9-7-8-10-15(14)22(24)25/h7-12H,4-6H2,1-3H3,(H2,20,21,23) |
| InChIKey | AIKFPSIUMAAEJQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|