C19H24N2O7S — CID 108869615
4-[(3,4,5-triethoxyphenyl)carbamoylamino]benzenesulfonic acid (PubChem CID 108869615) has the molecular formula C19H24N2O7S and a molecular weight of 424.48 g/mol. Its IUPAC name is 4-[(3,4,5-triethoxyphenyl)carbamoylamino]benzenesulfonic acid.
| Compound Name | 4-[(3,4,5-triethoxyphenyl)carbamoylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108869615 |
| Molecular Formula | C19H24N2O7S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 4-[(3,4,5-triethoxyphenyl)carbamoylamino]benzenesulfonic acid |
| SMILES | CCOc1cc(NC(=O)Nc2ccc(S(=O)(=O)O)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H24N2O7S/c1-4-26-16-11-14(12-17(27-5-2)18(16)28-6-3)21-19(22)20-13-7-9-15(10-8-13)29(23,24)25/h7-12H,4-6H2,1-3H3,(H2,20,21,22)(H,23,24,25) |
| InChIKey | VSBJGWUQDJGZQG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|