C21H28N2O4 — CID 108869864
1-(3,5-dimethylphenyl)-3-(3,4,5-triethoxyphenyl)urea (PubChem CID 108869864) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-(3,4,5-triethoxyphenyl)urea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-(3,4,5-triethoxyphenyl)urea |
|---|---|
| PubChem CID | 108869864 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-(3,4,5-triethoxyphenyl)urea |
| SMILES | CCOc1cc(NC(=O)Nc2cc(C)cc(C)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H28N2O4/c1-6-25-18-12-17(13-19(26-7-2)20(18)27-8-3)23-21(24)22-16-10-14(4)9-15(5)11-16/h9-13H,6-8H2,1-5H3,(H2,22,23,24) |
| InChIKey | QJRXJEKIRAQNLL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |