C21H27N3O5 — CID 108869808
N-[3-[(3,4,5-triethoxyphenyl)carbamoylamino]phenyl]acetamide (PubChem CID 108869808) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[3-[(3,4,5-triethoxyphenyl)carbamoylamino]phenyl]acetamide.
| Compound Name | N-[3-[(3,4,5-triethoxyphenyl)carbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 108869808 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | N-[3-[(3,4,5-triethoxyphenyl)carbamoylamino]phenyl]acetamide |
| SMILES | CCOc1cc(NC(=O)Nc2cccc(NC(C)=O)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H27N3O5/c1-5-27-18-12-17(13-19(28-6-2)20(18)29-7-3)24-21(26)23-16-10-8-9-15(11-16)22-14(4)25/h8-13H,5-7H2,1-4H3,(H,22,25)(H2,23,24,26) |
| InChIKey | MAKUPKWYDQMPAV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |