C20H26N2O4 — CID 108869610
1-(4-methylphenyl)-3-(3,4,5-triethoxyphenyl)urea (PubChem CID 108869610) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(3,4,5-triethoxyphenyl)urea.
| Compound Name | 1-(4-methylphenyl)-3-(3,4,5-triethoxyphenyl)urea |
|---|---|
| PubChem CID | 108869610 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-(4-methylphenyl)-3-(3,4,5-triethoxyphenyl)urea |
| SMILES | CCOc1cc(NC(=O)Nc2ccc(C)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H26N2O4/c1-5-24-17-12-16(13-18(25-6-2)19(17)26-7-3)22-20(23)21-15-10-8-14(4)9-11-15/h8-13H,5-7H2,1-4H3,(H2,21,22,23) |
| InChIKey | YTCZJVDWQMUKOC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |