C24H35N3O4 — CID 108869898
1-[4-(diethylamino)-2-methylphenyl]-3-(3,4,5-triethoxyphenyl)urea (PubChem CID 108869898) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is 1-[4-(diethylamino)-2-methylphenyl]-3-(3,4,5-triethoxyphenyl)urea.
| Compound Name | 1-[4-(diethylamino)-2-methylphenyl]-3-(3,4,5-triethoxyphenyl)urea |
|---|---|
| PubChem CID | 108869898 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 1-[4-(diethylamino)-2-methylphenyl]-3-(3,4,5-triethoxyphenyl)urea |
| SMILES | CCOc1cc(NC(=O)Nc2ccc(N(CC)CC)cc2C)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H35N3O4/c1-7-27(8-2)19-12-13-20(17(6)14-19)26-24(28)25-18-15-21(29-9-3)23(31-11-5)22(16-18)30-10-4/h12-16H,7-11H2,1-6H3,(H2,25,26,28) |
| InChIKey | AQJDGSNWBLFJPM-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|