C17H23N3O5 — CID 108869783
1-(5-methyl-1,2-oxazol-3-yl)-3-(3,4,5-triethoxyphenyl)urea (PubChem CID 108869783) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-(5-methyl-1,2-oxazol-3-yl)-3-(3,4,5-triethoxyphenyl)urea.
| Compound Name | 1-(5-methyl-1,2-oxazol-3-yl)-3-(3,4,5-triethoxyphenyl)urea |
|---|---|
| PubChem CID | 108869783 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-(5-methyl-1,2-oxazol-3-yl)-3-(3,4,5-triethoxyphenyl)urea |
| SMILES | CCOc1cc(NC(=O)Nc2cc(C)on2)cc(OCC)c1OCC |
| InChI | InChI=1S/C17H23N3O5/c1-5-22-13-9-12(10-14(23-6-2)16(13)24-7-3)18-17(21)19-15-8-11(4)25-20-15/h8-10H,5-7H2,1-4H3,(H2,18,19,20,21) |
| InChIKey | PLFGMEZRZLPHAO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |