C10H16N4O4 — CID 108812202
ethyl N-[2-[(5-methyl-1,2-oxazol-3-yl)carbamoylamino]ethyl]carbamate (PubChem CID 108812202) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is ethyl N-[2-[(5-methyl-1,2-oxazol-3-yl)carbamoylamino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[(5-methyl-1,2-oxazol-3-yl)carbamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108812202 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | ethyl N-[2-[(5-methyl-1,2-oxazol-3-yl)carbamoylamino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C10H16N4O4/c1-3-17-10(16)12-5-4-11-9(15)13-8-6-7(2)18-14-8/h6H,3-5H2,1-2H3,(H,12,16)(H2,11,13,14,15) |
| InChIKey | GSYQBTZOJZFIJF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|