C11H17N3O3 — CID 32532589
1-(5-methyl-1,2-oxazol-3-yl)-3-[2-[(2S)-oxolan-2-yl]ethyl]urea (PubChem CID 32532589) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 1-(5-methyl-1,2-oxazol-3-yl)-3-[2-[(2S)-oxolan-2-yl]ethyl]urea.
| Compound Name | 1-(5-methyl-1,2-oxazol-3-yl)-3-[2-[(2S)-oxolan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 32532589 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-(5-methyl-1,2-oxazol-3-yl)-3-[2-[(2S)-oxolan-2-yl]ethyl]urea |
| SMILES | Cc1cc(NC(=O)NCC[C@@H]2CCCO2)no1 |
| InChI | InChI=1S/C11H17N3O3/c1-8-7-10(14-17-8)13-11(15)12-5-4-9-3-2-6-16-9/h7,9H,2-6H2,1H3,(H2,12,13,14,15)/t9-/m0/s1 |
| InChIKey | SHSOHYKGKOUNMI-VIFPVBQESA-N |
| XLogP | 1.67 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |