C7H10ClN3O2 — CID 108812112
1-(2-chloroethyl)-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 108812112) has the molecular formula C7H10ClN3O2 and a molecular weight of 203.63 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-(2-chloroethyl)-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108812112 |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 1-(2-chloroethyl)-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)NCCCl)no1 |
| InChI | InChI=1S/C7H10ClN3O2/c1-5-4-6(11-13-5)10-7(12)9-3-2-8/h4H,2-3H2,1H3,(H2,9,10,11,12) |
| InChIKey | YPYUAYCGNSHAQC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|