C10H15ClN2O2 — CID 2777055
6-chloro-N-(5-methyl-1,2-oxazol-3-yl)hexanamide (PubChem CID 2777055) has the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. Its IUPAC name is 6-chloro-N-(5-methyl-1,2-oxazol-3-yl)hexanamide.
| Compound Name | 6-chloro-N-(5-methyl-1,2-oxazol-3-yl)hexanamide |
|---|---|
| PubChem CID | 2777055 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 6-chloro-N-(5-methyl-1,2-oxazol-3-yl)hexanamide |
| SMILES | Cc1cc(NC(=O)CCCCCCl)no1 |
| InChI | InChI=1S/C10H15ClN2O2/c1-8-7-9(13-15-8)12-10(14)5-3-2-4-6-11/h7H,2-6H2,1H3,(H,12,13,14) |
| InChIKey | MARXXYSJJLWPCJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|