C9H12ClN3O3 — CID 108513695
N-(3-chloropropyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide (PubChem CID 108513695) has the molecular formula C9H12ClN3O3 and a molecular weight of 245.67 g/mol. Its IUPAC name is N-(3-chloropropyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide.
| Compound Name | N-(3-chloropropyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 108513695 |
| Molecular Formula | C9H12ClN3O3 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | N-(3-chloropropyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NCCCCl)no1 |
| InChI | InChI=1S/C9H12ClN3O3/c1-6-5-7(13-16-6)12-9(15)8(14)11-4-2-3-10/h5H,2-4H2,1H3,(H,11,14)(H,12,13,15) |
| InChIKey | XOFXQXHVBBKGEC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|