C14H15N3O4 — CID 108503092
N-[2-(4-hydroxyphenyl)ethyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide (PubChem CID 108503092) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)ethyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide.
| Compound Name | N-[2-(4-hydroxyphenyl)ethyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 108503092 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NCCc2ccc(O)cc2)no1 |
| InChI | InChI=1S/C14H15N3O4/c1-9-8-12(17-21-9)16-14(20)13(19)15-7-6-10-2-4-11(18)5-3-10/h2-5,8,18H,6-7H2,1H3,(H,15,19)(H,16,17,20) |
| InChIKey | BCXNMDCPLXJKSR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|