C13H15N3O2 — CID 54905585
3-(4-aminophenyl)-N-(5-methyl-1,2-oxazol-3-yl)propanamide (PubChem CID 54905585) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-(4-aminophenyl)-N-(5-methyl-1,2-oxazol-3-yl)propanamide.
| Compound Name | 3-(4-aminophenyl)-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
|---|---|
| PubChem CID | 54905585 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 3-(4-aminophenyl)-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
| SMILES | Cc1cc(NC(=O)CCc2ccc(N)cc2)no1 |
| InChI | InChI=1S/C13H15N3O2/c1-9-8-12(16-18-9)15-13(17)7-4-10-2-5-11(14)6-3-10/h2-3,5-6,8H,4,7,14H2,1H3,(H,15,16,17) |
| InChIKey | BHIRBDYQLRVHBK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|