C12H11N3O4 — CID 108514273
N-(2-hydroxyphenyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide (PubChem CID 108514273) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide.
| Compound Name | N-(2-hydroxyphenyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 108514273 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | N-(2-hydroxyphenyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)Nc2ccccc2O)no1 |
| InChI | InChI=1S/C12H11N3O4/c1-7-6-10(15-19-7)14-12(18)11(17)13-8-4-2-3-5-9(8)16/h2-6,16H,1H3,(H,13,17)(H,14,15,18) |
| InChIKey | ZBHBKHLIKZLIDN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|