C12H13N3O3 — CID 108812172
1-(2-hydroxy-4-methylphenyl)-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 108812172) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 1-(2-hydroxy-4-methylphenyl)-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-(2-hydroxy-4-methylphenyl)-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108812172 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 1-(2-hydroxy-4-methylphenyl)-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(C)on2)c(O)c1 |
| InChI | InChI=1S/C12H13N3O3/c1-7-3-4-9(10(16)5-7)13-12(17)14-11-6-8(2)18-15-11/h3-6,16H,1-2H3,(H2,13,14,15,17) |
| InChIKey | QOWDMLWZWVGICY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|