C11H11N3O4 — CID 108895478
1-(3,5-dihydroxyphenyl)-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 108895478) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 1-(3,5-dihydroxyphenyl)-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-(3,5-dihydroxyphenyl)-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108895478 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 1-(3,5-dihydroxyphenyl)-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2cc(O)cc(O)c2)no1 |
| InChI | InChI=1S/C11H11N3O4/c1-6-2-10(14-18-6)13-11(17)12-7-3-8(15)5-9(16)4-7/h2-5,15-16H,1H3,(H2,12,13,14,17) |
| InChIKey | BISDBOIQKMRVSF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |