C10H10N4O2 — CID 47129987
1-(5-methyl-1,2-oxazol-3-yl)-3-pyridin-3-ylurea (PubChem CID 47129987) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 1-(5-methyl-1,2-oxazol-3-yl)-3-pyridin-3-ylurea.
| Compound Name | 1-(5-methyl-1,2-oxazol-3-yl)-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 47129987 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 1-(5-methyl-1,2-oxazol-3-yl)-3-pyridin-3-ylurea |
| SMILES | Cc1cc(NC(=O)Nc2cccnc2)no1 |
| InChI | InChI=1S/C10H10N4O2/c1-7-5-9(14-16-7)13-10(15)12-8-3-2-4-11-6-8/h2-6H,1H3,(H2,12,13,14,15) |
| InChIKey | CGXUZWGIWSLFFV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |