C9H13N3O2 — CID 108909931
1-(5-methyl-1,2-oxazol-3-yl)-3-(2-methylprop-1-enyl)urea (PubChem CID 108909931) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-(5-methyl-1,2-oxazol-3-yl)-3-(2-methylprop-1-enyl)urea.
| Compound Name | 1-(5-methyl-1,2-oxazol-3-yl)-3-(2-methylprop-1-enyl)urea |
|---|---|
| PubChem CID | 108909931 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 1-(5-methyl-1,2-oxazol-3-yl)-3-(2-methylprop-1-enyl)urea |
| SMILES | CC(C)=CNC(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C9H13N3O2/c1-6(2)5-10-9(13)11-8-4-7(3)14-12-8/h4-5H,1-3H3,(H2,10,11,12,13) |
| InChIKey | SKAVDIIKBJBBBS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |