C13H12BrN3O2 — CID 108908828
1-[(E)-2-(4-bromophenyl)ethenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 108908828) has the molecular formula C13H12BrN3O2 and a molecular weight of 322.16 g/mol. Its IUPAC name is 1-[(E)-2-(4-bromophenyl)ethenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-[(E)-2-(4-bromophenyl)ethenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108908828 |
| Molecular Formula | C13H12BrN3O2 |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 1-[(E)-2-(4-bromophenyl)ethenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)N/C=C/c2ccc(Br)cc2)no1 |
| InChI | InChI=1S/C13H12BrN3O2/c1-9-8-12(17-19-9)16-13(18)15-7-6-10-2-4-11(14)5-3-10/h2-8H,1H3,(H2,15,16,17,18)/b7-6+ |
| InChIKey | KRQMAPVMHYOBQJ-VOTSOKGWSA-N |
| XLogP | 3.54 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |