C21H19BrN2O4 — CID 11838390
(Z)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide (PubChem CID 11838390) has the molecular formula C21H19BrN2O4 and a molecular weight of 443.30 g/mol. Its IUPAC name is (Z)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide.
| Compound Name | (Z)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 11838390 |
| Molecular Formula | C21H19BrN2O4 |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | (Z)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
| SMILES | COc1ccc(/C=C\C(=O)Nc2cc(C)on2)cc1COc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H19BrN2O4/c1-14-11-20(24-28-14)23-21(25)10-4-15-3-9-19(26-2)16(12-15)13-27-18-7-5-17(22)6-8-18/h3-12H,13H2,1-2H3,(H,23,24,25)/b10-4- |
| InChIKey | ZHTMXCBEYMIWID-WMZJFQQLSA-N |
| XLogP | 4.99 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|