C25H25BrN2O4S — CID 998768
2-[3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]prop-2-enoylamino]-5-propan-2-ylthiophene-3-carboxamide (PubChem CID 998768) has the molecular formula C25H25BrN2O4S and a molecular weight of 529.46 g/mol. Its IUPAC name is 2-[3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]prop-2-enoylamino]-5-propan-2-ylthiophene-3-carboxamide.
| Compound Name | 2-[3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]prop-2-enoylamino]-5-propan-2-ylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 998768 |
| Molecular Formula | C25H25BrN2O4S |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | 2-[3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]prop-2-enoylamino]-5-propan-2-ylthiophene-3-carboxamide |
| SMILES | COc1ccc(C=CC(=O)Nc2sc(C(C)C)cc2C(N)=O)cc1COc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H25BrN2O4S/c1-15(2)22-13-20(24(27)30)25(33-22)28-23(29)11-5-16-4-10-21(31-3)17(12-16)14-32-19-8-6-18(26)7-9-19/h4-13,15H,14H2,1-3H3,(H2,27,30)(H,28,29) |
| InChIKey | OIRAVYUNRXWWKM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|