C7H6N2O5 — CID 130735467
3-[(5-methyl-1,2-oxazol-3-yl)amino]-2,3-dioxopropanoic acid (PubChem CID 130735467) has the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. Its IUPAC name is 3-[(5-methyl-1,2-oxazol-3-yl)amino]-2,3-dioxopropanoic acid.
| Compound Name | 3-[(5-methyl-1,2-oxazol-3-yl)amino]-2,3-dioxopropanoic acid |
|---|---|
| PubChem CID | 130735467 |
| Molecular Formula | C7H6N2O5 |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | 3-[(5-methyl-1,2-oxazol-3-yl)amino]-2,3-dioxopropanoic acid |
| SMILES | Cc1cc(NC(=O)C(=O)C(=O)O)no1 |
| InChI | InChI=1S/C7H6N2O5/c1-3-2-4(9-14-3)8-6(11)5(10)7(12)13/h2H,1H3,(H,12,13)(H,8,9,11) |
| InChIKey | QVCMKHWAPRJWIP-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|