C13H13N3O3 — CID 44996030
N'-(5-methyl-1,2-oxazol-3-yl)-N-(3-methylphenyl)oxamide (PubChem CID 44996030) has the molecular formula C13H13N3O3 and a molecular weight of 259.27 g/mol. Its IUPAC name is N'-(5-methyl-1,2-oxazol-3-yl)-N-(3-methylphenyl)oxamide.
| Compound Name | N'-(5-methyl-1,2-oxazol-3-yl)-N-(3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 44996030 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N'-(5-methyl-1,2-oxazol-3-yl)-N-(3-methylphenyl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)Nc2cc(C)on2)c1 |
| InChI | InChI=1S/C13H13N3O3/c1-8-4-3-5-10(6-8)14-12(17)13(18)15-11-7-9(2)19-16-11/h3-7H,1-2H3,(H,14,17)(H,15,16,18) |
| InChIKey | YFPHPGYKHJAMJC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|