C12H12N4O5S — CID 108508730
N'-(5-methyl-1,2-oxazol-3-yl)-N-(4-sulfamoylphenyl)oxamide (PubChem CID 108508730) has the molecular formula C12H12N4O5S and a molecular weight of 324.32 g/mol. Its IUPAC name is N'-(5-methyl-1,2-oxazol-3-yl)-N-(4-sulfamoylphenyl)oxamide.
| Compound Name | N'-(5-methyl-1,2-oxazol-3-yl)-N-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 108508730 |
| Molecular Formula | C12H12N4O5S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | N'-(5-methyl-1,2-oxazol-3-yl)-N-(4-sulfamoylphenyl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)Nc2ccc(S(N)(=O)=O)cc2)no1 |
| InChI | InChI=1S/C12H12N4O5S/c1-7-6-10(16-21-7)15-12(18)11(17)14-8-2-4-9(5-3-8)22(13,19)20/h2-6H,1H3,(H,14,17)(H2,13,19,20)(H,15,16,18) |
| InChIKey | GWZIXPAHEIYHNS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 144.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|