C12H9ClFN3O3 — CID 47245192
N-(3-chloro-4-fluorophenyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide (PubChem CID 47245192) has the molecular formula C12H9ClFN3O3 and a molecular weight of 297.67 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 47245192 |
| Molecular Formula | C12H9ClFN3O3 |
| Molecular Weight | 297.67 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)Nc2ccc(F)c(Cl)c2)no1 |
| InChI | InChI=1S/C12H9ClFN3O3/c1-6-4-10(17-20-6)16-12(19)11(18)15-7-2-3-9(14)8(13)5-7/h2-5H,1H3,(H,15,18)(H,16,17,19) |
| InChIKey | JCLKMUGMROWBPN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.67 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|