C14H11ClFN3O2 — CID 108530574
N-(3-chloro-4-fluorophenyl)-N'-(5-methyl-2-pyridinyl)oxamide (PubChem CID 108530574) has the molecular formula C14H11ClFN3O2 and a molecular weight of 307.71 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N'-(5-methyl-2-pyridinyl)oxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-N'-(5-methyl-2-pyridinyl)oxamide |
|---|---|
| PubChem CID | 108530574 |
| Molecular Formula | C14H11ClFN3O2 |
| Molecular Weight | 307.71 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N'-(5-methyl-2-pyridinyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)Nc2ccc(F)c(Cl)c2)nc1 |
| InChI | InChI=1S/C14H11ClFN3O2/c1-8-2-5-12(17-7-8)19-14(21)13(20)18-9-3-4-11(16)10(15)6-9/h2-7H,1H3,(H,18,20)(H,17,19,21) |
| InChIKey | KDCJLDHMNIXEFO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.71 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|