C14H12FN3O4S — CID 108508654
N-(4-fluorophenyl)-N'-(4-sulfamoylphenyl)oxamide (PubChem CID 108508654) has the molecular formula C14H12FN3O4S and a molecular weight of 337.33 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N'-(4-sulfamoylphenyl)oxamide.
| Compound Name | N-(4-fluorophenyl)-N'-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 108508654 |
| Molecular Formula | C14H12FN3O4S |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | N-(4-fluorophenyl)-N'-(4-sulfamoylphenyl)oxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C14H12FN3O4S/c15-9-1-3-10(4-2-9)17-13(19)14(20)18-11-5-7-12(8-6-11)23(16,21)22/h1-8H,(H,17,19)(H,18,20)(H2,16,21,22) |
| InChIKey | DIWXWPAPORBNCH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|