C9H7F5N2O3S — CID 91742405
2,2,3,3,3-pentafluoro-N-(4-sulfamoylphenyl)propanamide (PubChem CID 91742405) has the molecular formula C9H7F5N2O3S and a molecular weight of 318.22 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 91742405 |
| Molecular Formula | C9H7F5N2O3S |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(4-sulfamoylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F5N2O3S/c10-8(11,9(12,13)14)7(17)16-5-1-3-6(4-2-5)20(15,18)19/h1-4H,(H,16,17)(H2,15,18,19) |
| InChIKey | UMDIWOPABWGUDW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|